C20H34O4 — CID 57064472
ethyl (2S,6R)-6-[(1R,7aR)-7a-methyl-4-oxo-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-hydroxy-2-methylheptanoate (PubChem CID 57064472) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is ethyl (2S,6R)-6-[(1R,7aR)-7a-methyl-4-oxo-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-hydroxy-2-methylheptanoate.
| Compound Name | ethyl (2S,6R)-6-[(1R,7aR)-7a-methyl-4-oxo-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-hydroxy-2-methylheptanoate |
|---|---|
| PubChem CID | 57064472 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | ethyl (2S,6R)-6-[(1R,7aR)-7a-methyl-4-oxo-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-hydroxy-2-methylheptanoate |
| SMILES | CCOC(=O)[C@@](C)(O)CCC[C@@H](C)[C@H]1CCC2C(=O)CCC[C@@]21C |
| InChI | InChI=1S/C20H34O4/c1-5-24-18(22)20(4,23)13-6-8-14(2)15-10-11-16-17(21)9-7-12-19(15,16)3/h14-16,23H,5-13H2,1-4H3/t14-,15-,16?,19-,20+/m1/s1 |
| InChIKey | FEVDCEDAUQXPQP-QRMTWNFDSA-N |
| XLogP | 3.89 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |