C23H39NO3 — CID 71110185
tert-butyl N-[(4R)-4-[(1R,3aR,7aR)-7a-methyl-4-oxo-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]pentyl]-N-cyclopropylcarbamate (PubChem CID 71110185) has the molecular formula C23H39NO3 and a molecular weight of 377.57 g/mol. Its IUPAC name is tert-butyl N-[(4R)-4-[(1R,3aR,7aR)-7a-methyl-4-oxo-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]pentyl]-N-cyclopropylcarbamate.
| Compound Name | tert-butyl N-[(4R)-4-[(1R,3aR,7aR)-7a-methyl-4-oxo-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]pentyl]-N-cyclopropylcarbamate |
|---|---|
| PubChem CID | 71110185 |
| Molecular Formula | C23H39NO3 |
| Molecular Weight | 377.57 g/mol |
| Exact Mass | 377.29 |
| IUPAC Name | tert-butyl N-[(4R)-4-[(1R,3aR,7aR)-7a-methyl-4-oxo-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]pentyl]-N-cyclopropylcarbamate |
| SMILES | C[C@H](CCCN(C(=O)OC(C)(C)C)C1CC1)[C@H]1CC[C@H]2C(=O)CCC[C@]12C |
| InChI | InChI=1S/C23H39NO3/c1-16(18-12-13-19-20(25)9-6-14-23(18,19)5)8-7-15-24(17-10-11-17)21(26)27-22(2,3)4/h16-19H,6-15H2,1-5H3/t16-,18-,19+,23-/m1/s1 |
| InChIKey | ABVUPBNRDACCAH-YQYRJILISA-N |
| XLogP | 5.59 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.57 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |