C26H50O2Si — CID 71084663
(1R,3aR,7aR)-1-[(2S)-6,6-diethyl-8-[hydroxy(dimethyl)silyl]-8-methylnonan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one (PubChem CID 71084663) has the molecular formula C26H50O2Si and a molecular weight of 422.77 g/mol. Its IUPAC name is (1R,3aR,7aR)-1-[(2S)-6,6-diethyl-8-[hydroxy(dimethyl)silyl]-8-methylnonan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one.
| Compound Name | (1R,3aR,7aR)-1-[(2S)-6,6-diethyl-8-[hydroxy(dimethyl)silyl]-8-methylnonan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 71084663 |
| Molecular Formula | C26H50O2Si |
| Molecular Weight | 422.77 g/mol |
| Exact Mass | 422.36 |
| IUPAC Name | (1R,3aR,7aR)-1-[(2S)-6,6-diethyl-8-[hydroxy(dimethyl)silyl]-8-methylnonan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
| SMILES | CCC(CC)(CCC[C@H](C)[C@H]1CC[C@H]2C(=O)CCC[C@]12C)CC(C)(C)[Si](C)(C)O |
| InChI | InChI=1S/C26H50O2Si/c1-9-26(10-2,19-24(4,5)29(7,8)28)18-11-13-20(3)21-15-16-22-23(27)14-12-17-25(21,22)6/h20-22,28H,9-19H2,1-8H3/t20-,21+,22-,25+/m0/s1 |
| InChIKey | GXQNEZFTMXUYJV-XOEOCAAJSA-N |
| XLogP | 7.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.77 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|