C39H72O4Si2 — CID 170999929
ethyl 5-[4-[2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidenecyclohexylidene]ethyl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]hexanoate (PubChem CID 170999929) has the molecular formula C39H72O4Si2 and a molecular weight of 661.17 g/mol. Its IUPAC name is ethyl 5-[4-[2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidenecyclohexylidene]ethyl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]hexanoate.
| Compound Name | ethyl 5-[4-[2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidenecyclohexylidene]ethyl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]hexanoate |
|---|---|
| PubChem CID | 170999929 |
| Molecular Formula | C39H72O4Si2 |
| Molecular Weight | 661.17 g/mol |
| Exact Mass | 660.50 |
| IUPAC Name | ethyl 5-[4-[2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidenecyclohexylidene]ethyl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]hexanoate |
| SMILES | C=C1C(=CCC2CCCC3(C)C(C(C)CCCC(=O)OCC)CCC23)CC(O[Si](C)(C)C(C)(C)C)CC1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C39H72O4Si2/c1-15-41-36(40)20-16-18-28(2)33-23-24-34-30(19-17-25-39(33,34)10)21-22-31-26-32(42-44(11,12)37(4,5)6)27-35(29(31)3)43-45(13,14)38(7,8)9/h22,28,30,32-35H,3,15-21,23-27H2,1-2,4-14H3 |
| InChIKey | NUBKILNTQUZPAJ-UHFFFAOYSA-N |
| XLogP | 11.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.17 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|