C30H49F3O4SSi — CID 70475423
(3R)-6-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-3-(benzenesulfonyl)-1,1,1-trifluoro-2-methylheptan-2-ol (PubChem CID 70475423) has the molecular formula C30H49F3O4SSi and a molecular weight of 590.87 g/mol. Its IUPAC name is (3R)-6-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-3-(benzenesulfonyl)-1,1,1-trifluoro-2-methylheptan-2-ol.
| Compound Name | (3R)-6-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-3-(benzenesulfonyl)-1,1,1-trifluoro-2-methylheptan-2-ol |
|---|---|
| PubChem CID | 70475423 |
| Molecular Formula | C30H49F3O4SSi |
| Molecular Weight | 590.87 g/mol |
| Exact Mass | 590.31 |
| IUPAC Name | (3R)-6-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-3-(benzenesulfonyl)-1,1,1-trifluoro-2-methylheptan-2-ol |
| SMILES | CC(CC[C@H](C(C)(O)C(F)(F)F)S(=O)(=O)c1ccccc1)[C@H]1CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C30H49F3O4SSi/c1-21(16-19-26(29(6,34)30(31,32)33)38(35,36)22-13-10-9-11-14-22)23-17-18-24-25(15-12-20-28(23,24)5)37-39(7,8)27(2,3)4/h9-11,13-14,21,23-26,34H,12,15-20H2,1-8H3/t21?,23-,24+,25+,26-,28-,29?/m1/s1 |
| InChIKey | GSAVSJMALLFSMP-DJFGMMMGSA-N |
| XLogP | 8.17 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.87 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|