C28H48O2SSi — CID 10719392
2-[3-[(2R)-2-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]propyl]sulfanylphenyl]propan-2-ol (PubChem CID 10719392) has the molecular formula C28H48O2SSi and a molecular weight of 476.84 g/mol. Its IUPAC name is 2-[3-[(2R)-2-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]propyl]sulfanylphenyl]propan-2-ol.
| Compound Name | 2-[3-[(2R)-2-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]propyl]sulfanylphenyl]propan-2-ol |
|---|---|
| PubChem CID | 10719392 |
| Molecular Formula | C28H48O2SSi |
| Molecular Weight | 476.84 g/mol |
| Exact Mass | 476.31 |
| IUPAC Name | 2-[3-[(2R)-2-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]propyl]sulfanylphenyl]propan-2-ol |
| SMILES | C[C@@H](CSc1cccc(C(C)(C)O)c1)[C@H]1CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C28H48O2SSi/c1-20(19-31-22-13-10-12-21(18-22)27(5,6)29)23-15-16-24-25(14-11-17-28(23,24)7)30-32(8,9)26(2,3)4/h10,12-13,18,20,23-25,29H,11,14-17,19H2,1-9H3/t20-,23+,24-,25-,28+/m0/s1 |
| InChIKey | BXDUZJBNGUMTBH-CEXUTURCSA-N |
| XLogP | 8.25 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.84 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|