C20H31IO — CID 57020646
(1R,4S)-4-[(2R)-2-[(1R,7aR)-4-(iodomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-1-methylcyclopent-2-en-1-ol (PubChem CID 57020646) has the molecular formula C20H31IO and a molecular weight of 414.37 g/mol. Its IUPAC name is (1R,4S)-4-[(2R)-2-[(1R,7aR)-4-(iodomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-1-methylcyclopent-2-en-1-ol.
| Compound Name | (1R,4S)-4-[(2R)-2-[(1R,7aR)-4-(iodomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-1-methylcyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 57020646 |
| Molecular Formula | C20H31IO |
| Molecular Weight | 414.37 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | (1R,4S)-4-[(2R)-2-[(1R,7aR)-4-(iodomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-1-methylcyclopent-2-en-1-ol |
| SMILES | C[C@H](C[C@@H]1C=C[C@](C)(O)C1)[C@H]1CCC2C(=CI)CCC[C@@]21C |
| InChI | InChI=1S/C20H31IO/c1-14(11-15-8-10-19(2,22)12-15)17-6-7-18-16(13-21)5-4-9-20(17,18)3/h8,10,13-15,17-18,22H,4-7,9,11-12H2,1-3H3/t14-,15+,17-,18?,19+,20-/m1/s1 |
| InChIKey | IQYLDKXBGUAFDL-PRBKGLPDSA-N |
| XLogP | 5.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.37 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|