C23H38O — CID 59934827
(4E)-4-ethylidene-1-[1-(4-methoxy-3,4-dimethylcyclopent-2-en-1-yl)propan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-indene (PubChem CID 59934827) has the molecular formula C23H38O and a molecular weight of 330.56 g/mol. Its IUPAC name is (4E)-4-ethylidene-1-[1-(4-methoxy-3,4-dimethylcyclopent-2-en-1-yl)propan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-indene.
| Compound Name | (4E)-4-ethylidene-1-[1-(4-methoxy-3,4-dimethylcyclopent-2-en-1-yl)propan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-indene |
|---|---|
| PubChem CID | 59934827 |
| Molecular Formula | C23H38O |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 330.29 |
| IUPAC Name | (4E)-4-ethylidene-1-[1-(4-methoxy-3,4-dimethylcyclopent-2-en-1-yl)propan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-indene |
| SMILES | C/C=C1\CCCC2(C)C1CCC2C(C)CC1C=C(C)C(C)(OC)C1 |
| InChI | InChI=1S/C23H38O/c1-7-19-9-8-12-22(4)20(10-11-21(19)22)16(2)13-18-14-17(3)23(5,15-18)24-6/h7,14,16,18,20-21H,8-13,15H2,1-6H3/b19-7+ |
| InChIKey | JVOBNSJNTGMJKL-FBCYGCLPSA-N |
| XLogP | 6.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|