C23H39BrOSi — CID 70187226
[(1R,4R)-4-[(2R)-2-[(1R,7aS)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-1-methylcyclopent-2-en-1-yl]oxy-trimethylsilane (PubChem CID 70187226) has the molecular formula C23H39BrOSi and a molecular weight of 439.55 g/mol. Its IUPAC name is [(1R,4R)-4-[(2R)-2-[(1R,7aS)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-1-methylcyclopent-2-en-1-yl]oxy-trimethylsilane.
| Compound Name | [(1R,4R)-4-[(2R)-2-[(1R,7aS)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-1-methylcyclopent-2-en-1-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 70187226 |
| Molecular Formula | C23H39BrOSi |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | [(1R,4R)-4-[(2R)-2-[(1R,7aS)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-1-methylcyclopent-2-en-1-yl]oxy-trimethylsilane |
| SMILES | C[C@H](C[C@H]1C=C[C@](C)(O[Si](C)(C)C)C1)[C@H]1CCC2C(=CBr)CCC[C@]21C |
| InChI | InChI=1S/C23H39BrOSi/c1-17(14-18-11-13-22(2,15-18)25-26(4,5)6)20-9-10-21-19(16-24)8-7-12-23(20,21)3/h11,13,16-18,20-21H,7-10,12,14-15H2,1-6H3/t17-,18-,20-,21?,22+,23+/m1/s1 |
| InChIKey | RJYANFYDMCBWFD-GOUYWOOZSA-N |
| XLogP | 7.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|