C26H45BrOSi — CID 70187183
[(1S,4S)-4-[(2R)-2-[(1R,7aS)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-1-methylcyclopent-2-en-1-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 70187183) has the molecular formula C26H45BrOSi and a molecular weight of 481.64 g/mol. Its IUPAC name is [(1S,4S)-4-[(2R)-2-[(1R,7aS)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-1-methylcyclopent-2-en-1-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1S,4S)-4-[(2R)-2-[(1R,7aS)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-1-methylcyclopent-2-en-1-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 70187183 |
| Molecular Formula | C26H45BrOSi |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | [(1S,4S)-4-[(2R)-2-[(1R,7aS)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-1-methylcyclopent-2-en-1-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C[C@H](C[C@@H]1C=C[C@@](C)(O[Si](C)(C)C(C)(C)C)C1)[C@H]1CCC2C(=CBr)CCC[C@]21C |
| InChI | InChI=1S/C26H45BrOSi/c1-19(22-11-12-23-21(18-27)10-9-14-26(22,23)6)16-20-13-15-25(5,17-20)28-29(7,8)24(2,3)4/h13,15,18-20,22-23H,9-12,14,16-17H2,1-8H3/t19-,20+,22-,23?,25-,26+/m1/s1 |
| InChIKey | HFWISRRMPQAYFY-RIGJNUPUSA-N |
| XLogP | 8.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|