C25H45BrO3Si — CID 70184862
(2R,6R)-6-[(1R,7aS)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-[tert-butyl(dimethyl)silyl]oxy-2-methylheptanoic acid (PubChem CID 70184862) has the molecular formula C25H45BrO3Si and a molecular weight of 501.62 g/mol. Its IUPAC name is (2R,6R)-6-[(1R,7aS)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-[tert-butyl(dimethyl)silyl]oxy-2-methylheptanoic acid.
| Compound Name | (2R,6R)-6-[(1R,7aS)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-[tert-butyl(dimethyl)silyl]oxy-2-methylheptanoic acid |
|---|---|
| PubChem CID | 70184862 |
| Molecular Formula | C25H45BrO3Si |
| Molecular Weight | 501.62 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | (2R,6R)-6-[(1R,7aS)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-[tert-butyl(dimethyl)silyl]oxy-2-methylheptanoic acid |
| SMILES | C[C@H](CCC[C@@](C)(O[Si](C)(C)C(C)(C)C)C(=O)O)[C@H]1CCC2C(=CBr)CCC[C@]21C |
| InChI | InChI=1S/C25H45BrO3Si/c1-18(20-13-14-21-19(17-26)12-10-15-24(20,21)5)11-9-16-25(6,22(27)28)29-30(7,8)23(2,3)4/h17-18,20-21H,9-16H2,1-8H3,(H,27,28)/t18-,20-,21?,24+,25-/m1/s1 |
| InChIKey | RCXAPANOQRKNTC-CPNGTUIDSA-N |
| XLogP | 8.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.62 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|