C26H45IO2Si — CID 22882728
[(1S,4S)-4-[(2R)-2-[(1R,4E,7aR)-4-(iodomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propoxy]-1-methylcyclopent-2-en-1-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 22882728) has the molecular formula C26H45IO2Si and a molecular weight of 544.63 g/mol. Its IUPAC name is [(1S,4S)-4-[(2R)-2-[(1R,4E,7aR)-4-(iodomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propoxy]-1-methylcyclopent-2-en-1-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1S,4S)-4-[(2R)-2-[(1R,4E,7aR)-4-(iodomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propoxy]-1-methylcyclopent-2-en-1-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 22882728 |
| Molecular Formula | C26H45IO2Si |
| Molecular Weight | 544.63 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | [(1S,4S)-4-[(2R)-2-[(1R,4E,7aR)-4-(iodomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propoxy]-1-methylcyclopent-2-en-1-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C[C@@H](CO[C@@H]1C=C[C@@](C)(O[Si](C)(C)C(C)(C)C)C1)[C@H]1CCC2/C(=C/I)CCC[C@@]21C |
| InChI | InChI=1S/C26H45IO2Si/c1-19(22-11-12-23-20(17-27)10-9-14-26(22,23)6)18-28-21-13-15-25(5,16-21)29-30(7,8)24(2,3)4/h13,15,17,19,21-23H,9-12,14,16,18H2,1-8H3/b20-17+/t19-,21+,22+,23?,25+,26+/m0/s1 |
| InChIKey | RTUDBTLFSRPLOX-NWWSHAQJSA-N |
| XLogP | 8.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.63 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|