C32H50BrNO2Si — CID 90978619
5-[(2R)-2-[(1R,3aR,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-1-(2-phenylethyl)-3-propyl-3-trimethylsilyloxypyrrolidin-2-one (PubChem CID 90978619) has the molecular formula C32H50BrNO2Si and a molecular weight of 588.75 g/mol. Its IUPAC name is 5-[(2R)-2-[(1R,3aR,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-1-(2-phenylethyl)-3-propyl-3-trimethylsilyloxypyrrolidin-2-one.
| Compound Name | 5-[(2R)-2-[(1R,3aR,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-1-(2-phenylethyl)-3-propyl-3-trimethylsilyloxypyrrolidin-2-one |
|---|---|
| PubChem CID | 90978619 |
| Molecular Formula | C32H50BrNO2Si |
| Molecular Weight | 588.75 g/mol |
| Exact Mass | 587.28 |
| IUPAC Name | 5-[(2R)-2-[(1R,3aR,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-1-(2-phenylethyl)-3-propyl-3-trimethylsilyloxypyrrolidin-2-one |
| SMILES | CCCC1(O[Si](C)(C)C)CC(C[C@@H](C)[C@H]2CC[C@H]3C(=CBr)CCC[C@]23C)N(CCc2ccccc2)C1=O |
| InChI | InChI=1S/C32H50BrNO2Si/c1-7-18-32(36-37(4,5)6)22-27(34(30(32)35)20-17-25-12-9-8-10-13-25)21-24(2)28-15-16-29-26(23-33)14-11-19-31(28,29)3/h8-10,12-13,23-24,27-29H,7,11,14-22H2,1-6H3/t24-,27?,28-,29+,31-,32?/m1/s1 |
| InChIKey | AEPNSGSJAJOJDY-QTYCNSDRSA-N |
| XLogP | 8.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.75 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|