C34H48BrNO2Si — CID 123562092
5-[(2R)-2-[(1R,3aR,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-3-methyl-1-(2-naphthalen-2-ylethyl)-3-trimethylsilyloxypyrrolidin-2-one (PubChem CID 123562092) has the molecular formula C34H48BrNO2Si and a molecular weight of 610.75 g/mol. Its IUPAC name is 5-[(2R)-2-[(1R,3aR,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-3-methyl-1-(2-naphthalen-2-ylethyl)-3-trimethylsilyloxypyrrolidin-2-one.
| Compound Name | 5-[(2R)-2-[(1R,3aR,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-3-methyl-1-(2-naphthalen-2-ylethyl)-3-trimethylsilyloxypyrrolidin-2-one |
|---|---|
| PubChem CID | 123562092 |
| Molecular Formula | C34H48BrNO2Si |
| Molecular Weight | 610.75 g/mol |
| Exact Mass | 609.26 |
| IUPAC Name | 5-[(2R)-2-[(1R,3aR,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-3-methyl-1-(2-naphthalen-2-ylethyl)-3-trimethylsilyloxypyrrolidin-2-one |
| SMILES | C[C@H](CC1CC(C)(O[Si](C)(C)C)C(=O)N1CCc1ccc2ccccc2c1)[C@H]1CC[C@H]2C(=CBr)CCC[C@]12C |
| InChI | InChI=1S/C34H48BrNO2Si/c1-24(30-15-16-31-28(23-35)12-9-18-33(30,31)2)20-29-22-34(3,38-39(4,5)6)32(37)36(29)19-17-25-13-14-26-10-7-8-11-27(26)21-25/h7-8,10-11,13-14,21,23-24,29-31H,9,12,15-20,22H2,1-6H3/t24-,29?,30-,31+,33-,34?/m1/s1 |
| InChIKey | LQDYWPSTWJHOTO-RAKYOUCYSA-N |
| XLogP | 9.11 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.75 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|