C26H35BrO3 — CID 57174401
(2S,5R)-5-[(4R)-4-[(1R,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]pentyl]-5-methyl-2-phenyl-1,3-dioxolan-4-one (PubChem CID 57174401) has the molecular formula C26H35BrO3 and a molecular weight of 475.47 g/mol. Its IUPAC name is (2S,5R)-5-[(4R)-4-[(1R,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]pentyl]-5-methyl-2-phenyl-1,3-dioxolan-4-one.
| Compound Name | (2S,5R)-5-[(4R)-4-[(1R,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]pentyl]-5-methyl-2-phenyl-1,3-dioxolan-4-one |
|---|---|
| PubChem CID | 57174401 |
| Molecular Formula | C26H35BrO3 |
| Molecular Weight | 475.47 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | (2S,5R)-5-[(4R)-4-[(1R,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]pentyl]-5-methyl-2-phenyl-1,3-dioxolan-4-one |
| SMILES | C[C@H](CCC[C@@]1(C)O[C@H](c2ccccc2)OC1=O)[C@H]1CCC2C(=CBr)CCC[C@@]21C |
| InChI | InChI=1S/C26H35BrO3/c1-18(21-13-14-22-20(17-27)12-8-15-25(21,22)2)9-7-16-26(3)24(28)29-23(30-26)19-10-5-4-6-11-19/h4-6,10-11,17-18,21-23H,7-9,12-16H2,1-3H3/t18-,21-,22?,23-,25-,26-/m1/s1 |
| InChIKey | SHIIUJSEUWTCFJ-SGZIVAFUSA-N |
| XLogP | 7.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.47 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |