C22H40 — CID 142233136
(4E)-1-[(2R,5S)-5,6-dimethylheptan-2-yl]-7a-methyl-4-propylidene-2,3,3a,5,6,7-hexahydro-1H-indene (PubChem CID 142233136) has the molecular formula C22H40 and a molecular weight of 304.56 g/mol. Its IUPAC name is (4E)-1-[(2R,5S)-5,6-dimethylheptan-2-yl]-7a-methyl-4-propylidene-2,3,3a,5,6,7-hexahydro-1H-indene.
| Compound Name | (4E)-1-[(2R,5S)-5,6-dimethylheptan-2-yl]-7a-methyl-4-propylidene-2,3,3a,5,6,7-hexahydro-1H-indene |
|---|---|
| PubChem CID | 142233136 |
| Molecular Formula | C22H40 |
| Molecular Weight | 304.56 g/mol |
| Exact Mass | 304.31 |
| IUPAC Name | (4E)-1-[(2R,5S)-5,6-dimethylheptan-2-yl]-7a-methyl-4-propylidene-2,3,3a,5,6,7-hexahydro-1H-indene |
| SMILES | CC/C=C1\CCCC2(C)C1CCC2[C@H](C)CC[C@H](C)C(C)C |
| InChI | InChI=1S/C22H40/c1-7-9-19-10-8-15-22(6)20(13-14-21(19)22)18(5)12-11-17(4)16(2)3/h9,16-18,20-21H,7-8,10-15H2,1-6H3/b19-9+/t17-,18+,20?,21?,22?/m0/s1 |
| InChIKey | QCWAGSXDQFRASB-VNRPGPCBSA-N |
| XLogP | 7.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.56 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|