C21H38O2S — CID 91138235
2-[1-(6,6-dimethylheptan-2-yl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethanesulfinic acid (PubChem CID 91138235) has the molecular formula C21H38O2S and a molecular weight of 354.60 g/mol. Its IUPAC name is 2-[1-(6,6-dimethylheptan-2-yl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethanesulfinic acid.
| Compound Name | 2-[1-(6,6-dimethylheptan-2-yl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethanesulfinic acid |
|---|---|
| PubChem CID | 91138235 |
| Molecular Formula | C21H38O2S |
| Molecular Weight | 354.60 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | 2-[1-(6,6-dimethylheptan-2-yl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethanesulfinic acid |
| SMILES | CC(CCCC(C)(C)C)C1CCC2C(=CCS(=O)O)CCCC21C |
| InChI | InChI=1S/C21H38O2S/c1-16(8-6-13-20(2,3)4)18-10-11-19-17(12-15-24(22)23)9-7-14-21(18,19)5/h12,16,18-19H,6-11,13-15H2,1-5H3,(H,22,23) |
| InChIKey | CGFDVGRWOLUDIF-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.60 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|