C30H50 — CID 21337516
(4E)-1-(6,6-dimethylheptan-2-yl)-4-[2-(3,5-dimethyl-4-methylidenecyclohexylidene)ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-indene (PubChem CID 21337516) has the molecular formula C30H50 and a molecular weight of 410.73 g/mol. Its IUPAC name is (4E)-1-(6,6-dimethylheptan-2-yl)-4-[2-(3,5-dimethyl-4-methylidenecyclohexylidene)ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-indene.
| Compound Name | (4E)-1-(6,6-dimethylheptan-2-yl)-4-[2-(3,5-dimethyl-4-methylidenecyclohexylidene)ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-indene |
|---|---|
| PubChem CID | 21337516 |
| Molecular Formula | C30H50 |
| Molecular Weight | 410.73 g/mol |
| Exact Mass | 410.39 |
| IUPAC Name | (4E)-1-(6,6-dimethylheptan-2-yl)-4-[2-(3,5-dimethyl-4-methylidenecyclohexylidene)ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-indene |
| SMILES | C=C1C(C)CC(=C/C=C2\CCCC3(C)C2CCC3C(C)CCCC(C)(C)C)CC1C |
| InChI | InChI=1S/C30H50/c1-21(11-9-17-29(5,6)7)27-15-16-28-26(12-10-18-30(27,28)8)14-13-25-19-22(2)24(4)23(3)20-25/h13-14,21-23,27-28H,4,9-12,15-20H2,1-3,5-8H3/b25-13?,26-14+ |
| InChIKey | JNURPCXNRTZQOQ-MEKNXCQHSA-N |
| XLogP | 9.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.73 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|