C28H46O3 — CID 91403967
trans-(1R,3R)-5-[2-[(7aR)-1-(6-hydroxy-6-methyloctan-2-yl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol (PubChem CID 91403967) has the molecular formula C28H46O3 and a molecular weight of 430.67 g/mol. Its IUPAC name is trans-(1R,3R)-5-[2-[(7aR)-1-(6-hydroxy-6-methyloctan-2-yl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol.
| Compound Name | trans-(1R,3R)-5-[2-[(7aR)-1-(6-hydroxy-6-methyloctan-2-yl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol |
|---|---|
| PubChem CID | 91403967 |
| Molecular Formula | C28H46O3 |
| Molecular Weight | 430.67 g/mol |
| Exact Mass | 430.34 |
| IUPAC Name | trans-(1R,3R)-5-[2-[(7aR)-1-(6-hydroxy-6-methyloctan-2-yl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol |
| SMILES | C=C1[C@H](O)CC(=CC=C2CCC[C@@]3(C)C2CCC3C(C)CCCC(C)(O)CC)C[C@H]1O |
| InChI | InChI=1S/C28H46O3/c1-6-27(4,31)15-7-9-19(2)23-13-14-24-22(10-8-16-28(23,24)5)12-11-21-17-25(29)20(3)26(30)18-21/h11-12,19,23-26,29-31H,3,6-10,13-18H2,1-2,4-5H3/t19?,23?,24?,25-,26-,27?,28-/m1/s1 |
| InChIKey | MNNDTAIRVPCOJT-AHINVROQSA-N |
| XLogP | 6.09 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.67 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|