C27H43NO2 — CID 123547710
trans-(1R,3R)-5-[2-[(1R,3aS,7aR)-1-[(2R)-5-(cyclopropylamino)pentan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol (PubChem CID 123547710) has the molecular formula C27H43NO2 and a molecular weight of 413.65 g/mol. Its IUPAC name is trans-(1R,3R)-5-[2-[(1R,3aS,7aR)-1-[(2R)-5-(cyclopropylamino)pentan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol.
| Compound Name | trans-(1R,3R)-5-[2-[(1R,3aS,7aR)-1-[(2R)-5-(cyclopropylamino)pentan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol |
|---|---|
| PubChem CID | 123547710 |
| Molecular Formula | C27H43NO2 |
| Molecular Weight | 413.65 g/mol |
| Exact Mass | 413.33 |
| IUPAC Name | trans-(1R,3R)-5-[2-[(1R,3aS,7aR)-1-[(2R)-5-(cyclopropylamino)pentan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol |
| SMILES | C=C1[C@H](O)CC(=CC=C2CCC[C@]3(C)[C@@H]([C@H](C)CCCNC4CC4)CC[C@@H]23)C[C@H]1O |
| InChI | InChI=1S/C27H43NO2/c1-18(6-5-15-28-22-10-11-22)23-12-13-24-21(7-4-14-27(23,24)3)9-8-20-16-25(29)19(2)26(30)17-20/h8-9,18,22-26,28-30H,2,4-7,10-17H2,1,3H3/t18-,23-,24+,25-,26-,27-/m1/s1 |
| InChIKey | FLEHQRTTWKDNGI-BQBYKZPFSA-N |
| XLogP | 5.30 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.65 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|