C24H37FO2 — CID 58386219
trans-(1R,3R)-5-[(2E)-2-[(7aR)-1-[(2R)-4-fluoropentan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol (PubChem CID 58386219) has the molecular formula C24H37FO2 and a molecular weight of 376.56 g/mol. Its IUPAC name is trans-(1R,3R)-5-[(2E)-2-[(7aR)-1-[(2R)-4-fluoropentan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol.
| Compound Name | trans-(1R,3R)-5-[(2E)-2-[(7aR)-1-[(2R)-4-fluoropentan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol |
|---|---|
| PubChem CID | 58386219 |
| Molecular Formula | C24H37FO2 |
| Molecular Weight | 376.56 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | trans-(1R,3R)-5-[(2E)-2-[(7aR)-1-[(2R)-4-fluoropentan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol |
| SMILES | C=C1[C@H](O)CC(=C/C=C2\CCC[C@@]3(C)C2CCC3[C@H](C)CC(C)F)C[C@H]1O |
| InChI | InChI=1S/C24H37FO2/c1-15(12-16(2)25)20-9-10-21-19(6-5-11-24(20,21)4)8-7-18-13-22(26)17(3)23(27)14-18/h7-8,15-16,20-23,26-27H,3,5-6,9-14H2,1-2,4H3/b19-8+/t15-,16?,20?,21?,22-,23-,24-/m1/s1 |
| InChIKey | IUHSYUQSKKWUPE-BHUGIOKOSA-N |
| XLogP | 5.51 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.56 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|