C26H41FO3 — CID 89233386
trans-(1R,3R)-5-[(2E)-2-[(7aR)-1-[(2S)-4-fluoropentan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-(3-hydroxypropylidene)cyclohexane-1,3-diol (PubChem CID 89233386) has the molecular formula C26H41FO3 and a molecular weight of 420.61 g/mol. Its IUPAC name is trans-(1R,3R)-5-[(2E)-2-[(7aR)-1-[(2S)-4-fluoropentan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-(3-hydroxypropylidene)cyclohexane-1,3-diol.
| Compound Name | trans-(1R,3R)-5-[(2E)-2-[(7aR)-1-[(2S)-4-fluoropentan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-(3-hydroxypropylidene)cyclohexane-1,3-diol |
|---|---|
| PubChem CID | 89233386 |
| Molecular Formula | C26H41FO3 |
| Molecular Weight | 420.61 g/mol |
| Exact Mass | 420.30 |
| IUPAC Name | trans-(1R,3R)-5-[(2E)-2-[(7aR)-1-[(2S)-4-fluoropentan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-(3-hydroxypropylidene)cyclohexane-1,3-diol |
| SMILES | CC(F)C[C@H](C)C1CCC2/C(=C/C=C3C[C@@H](O)C(=CCCO)[C@H](O)C3)CCC[C@@]21C |
| InChI | InChI=1S/C26H41FO3/c1-17(14-18(2)27)22-10-11-23-20(6-4-12-26(22,23)3)9-8-19-15-24(29)21(7-5-13-28)25(30)16-19/h7-9,17-18,22-25,28-30H,4-6,10-16H2,1-3H3/b19-8-,20-9+,21-7+/t17-,18?,22?,23?,24+,25+,26+/m0/s1 |
| InChIKey | JBVVFQCNVFOAMS-WMONOAFHSA-N |
| XLogP | 5.26 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.61 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|