C31H48O4 — CID 91000882
trans-(1R,3R)-5-[2-[1-[(2R)-7-ethyl-7-hydroxynona-3,5-dien-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-(2-hydroxyethylidene)cyclohexane-1,3-diol (PubChem CID 91000882) has the molecular formula C31H48O4 and a molecular weight of 484.72 g/mol. Its IUPAC name is trans-(1R,3R)-5-[2-[1-[(2R)-7-ethyl-7-hydroxynona-3,5-dien-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-(2-hydroxyethylidene)cyclohexane-1,3-diol.
| Compound Name | trans-(1R,3R)-5-[2-[1-[(2R)-7-ethyl-7-hydroxynona-3,5-dien-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-(2-hydroxyethylidene)cyclohexane-1,3-diol |
|---|---|
| PubChem CID | 91000882 |
| Molecular Formula | C31H48O4 |
| Molecular Weight | 484.72 g/mol |
| Exact Mass | 484.36 |
| IUPAC Name | trans-(1R,3R)-5-[2-[1-[(2R)-7-ethyl-7-hydroxynona-3,5-dien-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-(2-hydroxyethylidene)cyclohexane-1,3-diol |
| SMILES | CCC(O)(C=CC=C[C@@H](C)C1CCC2C(=CC=C3C[C@@H](O)C(=CCO)[C@H](O)C3)CCCC21C)CC |
| InChI | InChI=1S/C31H48O4/c1-5-31(35,6-2)18-8-7-10-22(3)26-14-15-27-24(11-9-17-30(26,27)4)13-12-23-20-28(33)25(16-19-32)29(34)21-23/h7-8,10,12-13,16,18,22,26-29,32-35H,5-6,9,11,14-15,17,19-21H2,1-4H3/b10-7?,18-8?,23-12-,24-13?,25-16+/t22-,26?,27?,28-,29-,30?/m1/s1 |
| InChIKey | RSQHDALCQSYZTD-NPLDNPBBSA-N |
| XLogP | 5.79 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.72 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|