C26H39F2NO2 — CID 162761392
trans-(1R,3R)-5-[(2E)-2-[(1R,3aS,7aR)-1-[(2R)-1-[3-(difluoromethyl)azetidin-1-yl]propan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol (PubChem CID 162761392) has the molecular formula C26H39F2NO2 and a molecular weight of 435.60 g/mol. Its IUPAC name is trans-(1R,3R)-5-[(2E)-2-[(1R,3aS,7aR)-1-[(2R)-1-[3-(difluoromethyl)azetidin-1-yl]propan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol.
| Compound Name | trans-(1R,3R)-5-[(2E)-2-[(1R,3aS,7aR)-1-[(2R)-1-[3-(difluoromethyl)azetidin-1-yl]propan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol |
|---|---|
| PubChem CID | 162761392 |
| Molecular Formula | C26H39F2NO2 |
| Molecular Weight | 435.60 g/mol |
| Exact Mass | 435.29 |
| IUPAC Name | trans-(1R,3R)-5-[(2E)-2-[(1R,3aS,7aR)-1-[(2R)-1-[3-(difluoromethyl)azetidin-1-yl]propan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol |
| SMILES | C=C1[C@H](O)CC(=C/C=C2\CCC[C@]3(C)[C@@H]([C@@H](C)CN4CC(C(F)F)C4)CC[C@@H]23)C[C@H]1O |
| InChI | InChI=1S/C26H39F2NO2/c1-16(13-29-14-20(15-29)25(27)28)21-8-9-22-19(5-4-10-26(21,22)3)7-6-18-11-23(30)17(2)24(31)12-18/h6-7,16,20-25,30-31H,2,4-5,8-15H2,1,3H3/b19-7+/t16-,21+,22-,23+,24+,26+/m0/s1 |
| InChIKey | BJRZEGRCISPARJ-VPHRTOIRSA-N |
| XLogP | 4.96 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.60 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|