C28H45NO3 — CID 162761368
trans-(1R,3R)-5-[(2E)-2-[(1R,3aS,7aR)-1-[(2S)-1-(2,2-dimethylmorpholin-4-yl)propan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol (PubChem CID 162761368) has the molecular formula C28H45NO3 and a molecular weight of 443.67 g/mol. Its IUPAC name is trans-(1R,3R)-5-[(2E)-2-[(1R,3aS,7aR)-1-[(2S)-1-(2,2-dimethylmorpholin-4-yl)propan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol.
| Compound Name | trans-(1R,3R)-5-[(2E)-2-[(1R,3aS,7aR)-1-[(2S)-1-(2,2-dimethylmorpholin-4-yl)propan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol |
|---|---|
| PubChem CID | 162761368 |
| Molecular Formula | C28H45NO3 |
| Molecular Weight | 443.67 g/mol |
| Exact Mass | 443.34 |
| IUPAC Name | trans-(1R,3R)-5-[(2E)-2-[(1R,3aS,7aR)-1-[(2S)-1-(2,2-dimethylmorpholin-4-yl)propan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol |
| SMILES | C=C1[C@H](O)CC(=C/C=C2\CCC[C@]3(C)[C@@H]([C@H](C)CN4CCOC(C)(C)C4)CC[C@@H]23)C[C@H]1O |
| InChI | InChI=1S/C28H45NO3/c1-19(17-29-13-14-32-27(3,4)18-29)23-10-11-24-22(7-6-12-28(23,24)5)9-8-21-15-25(30)20(2)26(31)16-21/h8-9,19,23-26,30-31H,2,6-7,10-18H2,1,3-5H3/b22-9+/t19-,23-,24+,25-,26-,28-/m1/s1 |
| InChIKey | RZOHYYKXHSILFX-DACQGKNNSA-N |
| XLogP | 4.87 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.67 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|