C29H47NO3 — CID 162761263
trans-(1R,3R)-5-[(2E)-2-[(1R,3aS,7aR)-1-[(2R)-4-(2,2-dimethylmorpholin-4-yl)butan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol (PubChem CID 162761263) has the molecular formula C29H47NO3 and a molecular weight of 457.70 g/mol. Its IUPAC name is trans-(1R,3R)-5-[(2E)-2-[(1R,3aS,7aR)-1-[(2R)-4-(2,2-dimethylmorpholin-4-yl)butan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol.
| Compound Name | trans-(1R,3R)-5-[(2E)-2-[(1R,3aS,7aR)-1-[(2R)-4-(2,2-dimethylmorpholin-4-yl)butan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol |
|---|---|
| PubChem CID | 162761263 |
| Molecular Formula | C29H47NO3 |
| Molecular Weight | 457.70 g/mol |
| Exact Mass | 457.36 |
| IUPAC Name | trans-(1R,3R)-5-[(2E)-2-[(1R,3aS,7aR)-1-[(2R)-4-(2,2-dimethylmorpholin-4-yl)butan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexane-1,3-diol |
| SMILES | C=C1[C@H](O)CC(=C/C=C2\CCC[C@]3(C)[C@@H]([C@H](C)CCN4CCOC(C)(C)C4)CC[C@@H]23)C[C@H]1O |
| InChI | InChI=1S/C29H47NO3/c1-20(12-14-30-15-16-33-28(3,4)19-30)24-10-11-25-23(7-6-13-29(24,25)5)9-8-22-17-26(31)21(2)27(32)18-22/h8-9,20,24-27,31-32H,2,6-7,10-19H2,1,3-5H3/b23-9+/t20-,24-,25+,26-,27-,29-/m1/s1 |
| InChIKey | OKIBVJRMIRRJAN-WGUBIOPNSA-N |
| XLogP | 5.26 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.70 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|