C30H50O — CID 130348682
trans-(1R,3R,5E)-5-[(2E)-2-[(7aR)-7a-methyl-1-[(2R,3R)-3,6,6-trimethylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-3-methyl-2-methylidenecyclohexan-1-ol (PubChem CID 130348682) has the molecular formula C30H50O and a molecular weight of 426.73 g/mol. Its IUPAC name is trans-(1R,3R,5E)-5-[(2E)-2-[(7aR)-7a-methyl-1-[(2R,3R)-3,6,6-trimethylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-3-methyl-2-methylidenecyclohexan-1-ol.
| Compound Name | trans-(1R,3R,5E)-5-[(2E)-2-[(7aR)-7a-methyl-1-[(2R,3R)-3,6,6-trimethylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-3-methyl-2-methylidenecyclohexan-1-ol |
|---|---|
| PubChem CID | 130348682 |
| Molecular Formula | C30H50O |
| Molecular Weight | 426.73 g/mol |
| Exact Mass | 426.39 |
| IUPAC Name | trans-(1R,3R,5E)-5-[(2E)-2-[(7aR)-7a-methyl-1-[(2R,3R)-3,6,6-trimethylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-3-methyl-2-methylidenecyclohexan-1-ol |
| SMILES | C=C1[C@H](C)C/C(=C\C=C2/CCC[C@@]3(C)C2CCC3[C@H](C)[C@H](C)CCC(C)(C)C)C[C@H]1O |
| InChI | InChI=1S/C30H50O/c1-20(15-17-29(5,6)7)22(3)26-13-14-27-25(10-9-16-30(26,27)8)12-11-24-18-21(2)23(4)28(31)19-24/h11-12,20-22,26-28,31H,4,9-10,13-19H2,1-3,5-8H3/b24-11+,25-12+/t20-,21-,22-,26?,27?,28-,30-/m1/s1 |
| InChIKey | NGRQTCQLVVKGNB-HOQSLAJRSA-N |
| XLogP | 8.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.73 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|