C31H52O2 — CID 58446710
(4E,7aR)-1-[(2S,3R)-6-methoxy-3,6-dimethylheptan-2-yl]-4-[(2Z)-2-[(3R,5R)-3-methoxy-5-methyl-4-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-indene (PubChem CID 58446710) has the molecular formula C31H52O2 and a molecular weight of 456.76 g/mol. Its IUPAC name is (4E,7aR)-1-[(2S,3R)-6-methoxy-3,6-dimethylheptan-2-yl]-4-[(2Z)-2-[(3R,5R)-3-methoxy-5-methyl-4-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-indene.
| Compound Name | (4E,7aR)-1-[(2S,3R)-6-methoxy-3,6-dimethylheptan-2-yl]-4-[(2Z)-2-[(3R,5R)-3-methoxy-5-methyl-4-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-indene |
|---|---|
| PubChem CID | 58446710 |
| Molecular Formula | C31H52O2 |
| Molecular Weight | 456.76 g/mol |
| Exact Mass | 456.40 |
| IUPAC Name | (4E,7aR)-1-[(2S,3R)-6-methoxy-3,6-dimethylheptan-2-yl]-4-[(2Z)-2-[(3R,5R)-3-methoxy-5-methyl-4-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-indene |
| SMILES | C=C1[C@H](C)C/C(=C/C=C2\CCC[C@@]3(C)C2CCC3[C@@H](C)[C@H](C)CCC(C)(C)OC)C[C@H]1OC |
| InChI | InChI=1S/C31H52O2/c1-21(16-18-30(5,6)33-9)23(3)27-14-15-28-26(11-10-17-31(27,28)7)13-12-25-19-22(2)24(4)29(20-25)32-8/h12-13,21-23,27-29H,4,10-11,14-20H2,1-3,5-9H3/b25-12-,26-13+/t21-,22-,23+,27?,28?,29-,31-/m1/s1 |
| InChIKey | WOPJCXUFGFNQIT-VNPVWXDESA-N |
| XLogP | 8.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.76 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|