C26H42O2 — CID 88936807
[(1R,3R,5Z)-5-[(2E)-2-[(1R,3aS,7aR)-7a-methyl-1-(2-methylbutan-2-yl)-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-3-methoxy-2-methylidenecyclohexyl]methanol (PubChem CID 88936807) has the molecular formula C26H42O2 and a molecular weight of 386.62 g/mol. Its IUPAC name is [(1R,3R,5Z)-5-[(2E)-2-[(1R,3aS,7aR)-7a-methyl-1-(2-methylbutan-2-yl)-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-3-methoxy-2-methylidenecyclohexyl]methanol.
| Compound Name | [(1R,3R,5Z)-5-[(2E)-2-[(1R,3aS,7aR)-7a-methyl-1-(2-methylbutan-2-yl)-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-3-methoxy-2-methylidenecyclohexyl]methanol |
|---|---|
| PubChem CID | 88936807 |
| Molecular Formula | C26H42O2 |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 386.32 |
| IUPAC Name | [(1R,3R,5Z)-5-[(2E)-2-[(1R,3aS,7aR)-7a-methyl-1-(2-methylbutan-2-yl)-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-3-methoxy-2-methylidenecyclohexyl]methanol |
| SMILES | C=C1[C@H](CO)C/C(=C/C=C2\CCC[C@]3(C)[C@@H](C(C)(C)CC)CC[C@@H]23)C[C@H]1OC |
| InChI | InChI=1S/C26H42O2/c1-7-25(3,4)24-13-12-22-20(9-8-14-26(22,24)5)11-10-19-15-21(17-27)18(2)23(16-19)28-6/h10-11,21-24,27H,2,7-9,12-17H2,1,3-6H3/b19-10-,20-11+/t21-,22-,23+,24+,26-/m0/s1 |
| InChIKey | XKFOQZLNFISVDJ-YIFFKOTNSA-N |
| XLogP | 6.47 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|