C35H61NO2Si2 — CID 134984740
(3S)-3-[(4E)-4-[2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butanenitrile (PubChem CID 134984740) has the molecular formula C35H61NO2Si2 and a molecular weight of 584.05 g/mol. Its IUPAC name is (3S)-3-[(4E)-4-[2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butanenitrile.
| Compound Name | (3S)-3-[(4E)-4-[2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butanenitrile |
|---|---|
| PubChem CID | 134984740 |
| Molecular Formula | C35H61NO2Si2 |
| Molecular Weight | 584.05 g/mol |
| Exact Mass | 583.42 |
| IUPAC Name | (3S)-3-[(4E)-4-[2-[3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butanenitrile |
| SMILES | C=C1C(O[Si](C)(C)C(C)(C)C)CC(=C/C=C2\CCCC3(C)C2CCC3[C@@H](C)CC#N)CC1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C35H61NO2Si2/c1-25(20-22-36)29-18-19-30-28(15-14-21-35(29,30)9)17-16-27-23-31(37-39(10,11)33(3,4)5)26(2)32(24-27)38-40(12,13)34(6,7)8/h16-17,25,29-32H,2,14-15,18-21,23-24H2,1,3-13H3/b27-16?,28-17+/t25-,29?,30?,31?,32?,35?/m0/s1 |
| InChIKey | FDNMRQXVVZGTJW-GWRDORINSA-N |
| XLogP | 10.74 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.05 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|