C29H48 — CID 20751368
(4E)-4-[2-(3,5-dimethyl-4-methylidenecyclohexylidene)ethylidene]-7a-methyl-1-(6-methylheptan-2-yl)-2,3,3a,5,6,7-hexahydro-1H-indene (PubChem CID 20751368) has the molecular formula C29H48 and a molecular weight of 396.70 g/mol. Its IUPAC name is (4E)-4-[2-(3,5-dimethyl-4-methylidenecyclohexylidene)ethylidene]-7a-methyl-1-(6-methylheptan-2-yl)-2,3,3a,5,6,7-hexahydro-1H-indene.
| Compound Name | (4E)-4-[2-(3,5-dimethyl-4-methylidenecyclohexylidene)ethylidene]-7a-methyl-1-(6-methylheptan-2-yl)-2,3,3a,5,6,7-hexahydro-1H-indene |
|---|---|
| PubChem CID | 20751368 |
| Molecular Formula | C29H48 |
| Molecular Weight | 396.70 g/mol |
| Exact Mass | 396.38 |
| IUPAC Name | (4E)-4-[2-(3,5-dimethyl-4-methylidenecyclohexylidene)ethylidene]-7a-methyl-1-(6-methylheptan-2-yl)-2,3,3a,5,6,7-hexahydro-1H-indene |
| SMILES | C=C1C(C)CC(=C/C=C2\CCCC3(C)C2CCC3C(C)CCCC(C)C)CC1C |
| InChI | InChI=1S/C29H48/c1-20(2)10-8-11-21(3)27-15-16-28-26(12-9-17-29(27,28)7)14-13-25-18-22(4)24(6)23(5)19-25/h13-14,20-23,27-28H,6,8-12,15-19H2,1-5,7H3/b25-13?,26-14+ |
| InChIKey | XEYDXLMITBIHMK-MEKNXCQHSA-N |
| XLogP | 9.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.70 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|