C27H46O — CID 142820667
(2S,5Z)-5-[(2E)-2-[7a-methyl-1-(6-methylheptan-2-yl)-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylcyclohexan-1-ol (PubChem CID 142820667) has the molecular formula C27H46O and a molecular weight of 386.66 g/mol. Its IUPAC name is (2S,5Z)-5-[(2E)-2-[7a-methyl-1-(6-methylheptan-2-yl)-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylcyclohexan-1-ol.
| Compound Name | (2S,5Z)-5-[(2E)-2-[7a-methyl-1-(6-methylheptan-2-yl)-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 142820667 |
| Molecular Formula | C27H46O |
| Molecular Weight | 386.66 g/mol |
| Exact Mass | 386.35 |
| IUPAC Name | (2S,5Z)-5-[(2E)-2-[7a-methyl-1-(6-methylheptan-2-yl)-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylcyclohexan-1-ol |
| SMILES | CC(C)CCCC(C)C1CCC2/C(=C/C=C3/CC[C@H](C)C(O)C3)CCCC21C |
| InChI | InChI=1S/C27H46O/c1-19(2)8-6-9-20(3)24-15-16-25-23(10-7-17-27(24,25)5)14-13-22-12-11-21(4)26(28)18-22/h13-14,19-21,24-26,28H,6-12,15-18H2,1-5H3/b22-13-,23-14+/t20?,21-,24?,25?,26?,27?/m0/s1 |
| InChIKey | VTEXUGGPXTZUSO-XTKXEWFTSA-N |
| XLogP | 7.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.66 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |