C28H48O — CID 142108749
6-[(4E)-4-[(2Z)-2-(3,4-dimethylcyclohexylidene)ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-ol (PubChem CID 142108749) has the molecular formula C28H48O and a molecular weight of 400.69 g/mol. Its IUPAC name is 6-[(4E)-4-[(2Z)-2-(3,4-dimethylcyclohexylidene)ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-ol.
| Compound Name | 6-[(4E)-4-[(2Z)-2-(3,4-dimethylcyclohexylidene)ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-ol |
|---|---|
| PubChem CID | 142108749 |
| Molecular Formula | C28H48O |
| Molecular Weight | 400.69 g/mol |
| Exact Mass | 400.37 |
| IUPAC Name | 6-[(4E)-4-[(2Z)-2-(3,4-dimethylcyclohexylidene)ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-ol |
| SMILES | CC1CC/C(=C/C=C2\CCCC3(C)C2CCC3C(C)CCCC(C)(C)O)CC1C |
| InChI | InChI=1S/C28H48O/c1-20-11-12-23(19-22(20)3)13-14-24-10-8-18-28(6)25(15-16-26(24)28)21(2)9-7-17-27(4,5)29/h13-14,20-22,25-26,29H,7-12,15-19H2,1-6H3/b23-13-,24-14+ |
| InChIKey | LXXDUSNXGSKBJV-NQGGHMMCSA-N |
| XLogP | 8.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.69 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |