C29H48O3 — CID 10049140
trans-(1R,3R)-5-[(2E)-2-[(1R,3aS,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-prop-2-enylcyclohexane-1,3-diol (PubChem CID 10049140) has the molecular formula C29H48O3 and a molecular weight of 444.70 g/mol. Its IUPAC name is trans-(1R,3R)-5-[(2E)-2-[(1R,3aS,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-prop-2-enylcyclohexane-1,3-diol.
| Compound Name | trans-(1R,3R)-5-[(2E)-2-[(1R,3aS,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-prop-2-enylcyclohexane-1,3-diol |
|---|---|
| PubChem CID | 10049140 |
| Molecular Formula | C29H48O3 |
| Molecular Weight | 444.70 g/mol |
| Exact Mass | 444.36 |
| IUPAC Name | trans-(1R,3R)-5-[(2E)-2-[(1R,3aS,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-prop-2-enylcyclohexane-1,3-diol |
| SMILES | C=CCC1[C@H](O)CC(=C/C=C2\CCC[C@]3(C)[C@@H]([C@H](C)CCCC(C)(C)O)CC[C@@H]23)C[C@H]1O |
| InChI | InChI=1S/C29H48O3/c1-6-9-23-26(30)18-21(19-27(23)31)12-13-22-11-8-17-29(5)24(14-15-25(22)29)20(2)10-7-16-28(3,4)32/h6,12-13,20,23-27,30-32H,1,7-11,14-19H2,2-5H3/b21-12-,22-13+/t20-,23?,24-,25+,26-,27-,29-/m1/s1 |
| InChIKey | UQIIFDFTJLDGBM-MPSYIHSFSA-N |
| XLogP | 6.34 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.70 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|