C28H44O3 — CID 44517698
(4R,6E)-6-[(2Z)-2-[(3aS,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4,5,7,7a-tetrahydro-2H-1-benzofuran-4-ol (PubChem CID 44517698) has the molecular formula C28H44O3 and a molecular weight of 428.66 g/mol. Its IUPAC name is (4R,6E)-6-[(2Z)-2-[(3aS,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4,5,7,7a-tetrahydro-2H-1-benzofuran-4-ol.
| Compound Name | (4R,6E)-6-[(2Z)-2-[(3aS,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4,5,7,7a-tetrahydro-2H-1-benzofuran-4-ol |
|---|---|
| PubChem CID | 44517698 |
| Molecular Formula | C28H44O3 |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 428.33 |
| IUPAC Name | (4R,6E)-6-[(2Z)-2-[(3aS,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4,5,7,7a-tetrahydro-2H-1-benzofuran-4-ol |
| SMILES | C[C@H](CCCC(C)(C)O)C1CC[C@H]2/C(=C\C=C3\CC4OCC=C4[C@H](O)C3)CCC[C@]12C |
| InChI | InChI=1S/C28H44O3/c1-19(7-5-14-27(2,3)30)23-11-12-24-21(8-6-15-28(23,24)4)10-9-20-17-25(29)22-13-16-31-26(22)18-20/h9-10,13,19,23-26,29-30H,5-8,11-12,14-18H2,1-4H3/b20-9+,21-10-/t19-,23?,24+,25-,26?,28-/m1/s1 |
| InChIKey | CNEVIMZKLQZGAV-DECLZQIPSA-N |
| XLogP | 6.11 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|