C28H46O2 — CID 88928379
cis-(1R,2R,5E)-5-[(2E)-2-[(1R,3aR,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methyl-3-methylidenecyclohexan-1-ol (PubChem CID 88928379) has the molecular formula C28H46O2 and a molecular weight of 414.67 g/mol. Its IUPAC name is cis-(1R,2R,5E)-5-[(2E)-2-[(1R,3aR,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methyl-3-methylidenecyclohexan-1-ol.
| Compound Name | cis-(1R,2R,5E)-5-[(2E)-2-[(1R,3aR,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methyl-3-methylidenecyclohexan-1-ol |
|---|---|
| PubChem CID | 88928379 |
| Molecular Formula | C28H46O2 |
| Molecular Weight | 414.67 g/mol |
| Exact Mass | 414.35 |
| IUPAC Name | cis-(1R,2R,5E)-5-[(2E)-2-[(1R,3aR,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methyl-3-methylidenecyclohexan-1-ol |
| SMILES | C=C1C/C(=C\C=C2/CCC[C@@]3(C)[C@@H]2CC[C@@H]3[C@H](C)CCCC(C)(C)O)C[C@@H](O)[C@@H]1C |
| InChI | InChI=1S/C28H46O2/c1-19(9-7-15-27(4,5)30)24-13-14-25-23(10-8-16-28(24,25)6)12-11-22-17-20(2)21(3)26(29)18-22/h11-12,19,21,24-26,29-30H,2,7-10,13-18H2,1,3-6H3/b22-11+,23-12+/t19-,21-,24-,25-,26-,28-/m1/s1 |
| InChIKey | JXNNKYQIBYPWGK-XZUQBROBSA-N |
| XLogP | 6.98 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.67 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|