C28H48O — CID 123712759
5-[2-[7a-methyl-1-(6-methylheptan-2-yl)-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2,3-dimethylcyclohexan-1-ol (PubChem CID 123712759) has the molecular formula C28H48O and a molecular weight of 400.69 g/mol. Its IUPAC name is 5-[2-[7a-methyl-1-(6-methylheptan-2-yl)-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2,3-dimethylcyclohexan-1-ol.
| Compound Name | 5-[2-[7a-methyl-1-(6-methylheptan-2-yl)-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2,3-dimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 123712759 |
| Molecular Formula | C28H48O |
| Molecular Weight | 400.69 g/mol |
| Exact Mass | 400.37 |
| IUPAC Name | 5-[2-[7a-methyl-1-(6-methylheptan-2-yl)-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2,3-dimethylcyclohexan-1-ol |
| SMILES | CC(C)CCCC(C)C1CCC2C(=CC=C3CC(C)C(C)C(O)C3)CCCC21C |
| InChI | InChI=1S/C28H48O/c1-19(2)9-7-10-20(3)25-14-15-26-24(11-8-16-28(25,26)6)13-12-23-17-21(4)22(5)27(29)18-23/h12-13,19-22,25-27,29H,7-11,14-18H2,1-6H3 |
| InChIKey | WCTKXJSDAZOHHT-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.69 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |