C28H48 — CID 59859775
(1R,3aS,4E,7aR)-1-[(2R)-heptan-2-yl]-7a-methyl-4-[2-[(3R,5R)-3,4,5-trimethylcyclohexylidene]ethylidene]-2,3,3a,5,6,7-hexahydro-1H-indene (PubChem CID 59859775) has the molecular formula C28H48 and a molecular weight of 384.69 g/mol. Its IUPAC name is (1R,3aS,4E,7aR)-1-[(2R)-heptan-2-yl]-7a-methyl-4-[2-[(3R,5R)-3,4,5-trimethylcyclohexylidene]ethylidene]-2,3,3a,5,6,7-hexahydro-1H-indene.
| Compound Name | (1R,3aS,4E,7aR)-1-[(2R)-heptan-2-yl]-7a-methyl-4-[2-[(3R,5R)-3,4,5-trimethylcyclohexylidene]ethylidene]-2,3,3a,5,6,7-hexahydro-1H-indene |
|---|---|
| PubChem CID | 59859775 |
| Molecular Formula | C28H48 |
| Molecular Weight | 384.69 g/mol |
| Exact Mass | 384.38 |
| IUPAC Name | (1R,3aS,4E,7aR)-1-[(2R)-heptan-2-yl]-7a-methyl-4-[2-[(3R,5R)-3,4,5-trimethylcyclohexylidene]ethylidene]-2,3,3a,5,6,7-hexahydro-1H-indene |
| SMILES | CCCCC[C@@H](C)[C@H]1CC[C@H]2/C(=C/C=C3C[C@@H](C)C(C)[C@H](C)C3)CCC[C@]12C |
| InChI | InChI=1S/C28H48/c1-7-8-9-11-20(2)26-15-16-27-25(12-10-17-28(26,27)6)14-13-24-18-21(3)23(5)22(4)19-24/h13-14,20-23,26-27H,7-12,15-19H2,1-6H3/b24-13-,25-14+/t20-,21-,22-,23?,26-,27+,28-/m1/s1 |
| InChIKey | HHOWWDUGJXFBSS-DDRLSEBUSA-N |
| XLogP | 8.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.69 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|