C26H44O — CID 87627665
(1S,3E)-3-[(2E)-2-[(1R,3aS,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]cyclohexan-1-ol (PubChem CID 87627665) has the molecular formula C26H44O and a molecular weight of 372.64 g/mol. Its IUPAC name is (1S,3E)-3-[(2E)-2-[(1R,3aS,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]cyclohexan-1-ol.
| Compound Name | (1S,3E)-3-[(2E)-2-[(1R,3aS,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]cyclohexan-1-ol |
|---|---|
| PubChem CID | 87627665 |
| Molecular Formula | C26H44O |
| Molecular Weight | 372.64 g/mol |
| Exact Mass | 372.34 |
| IUPAC Name | (1S,3E)-3-[(2E)-2-[(1R,3aS,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]cyclohexan-1-ol |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2/C(=C/C=C3\CCC[C@H](O)C3)CCC[C@]12C |
| InChI | InChI=1S/C26H44O/c1-19(2)8-5-9-20(3)24-15-16-25-22(11-7-17-26(24,25)4)14-13-21-10-6-12-23(27)18-21/h13-14,19-20,23-25,27H,5-12,15-18H2,1-4H3/b21-13+,22-14+/t20-,23+,24-,25+,26-/m1/s1 |
| InChIKey | YSBIKTNFISAUEE-BDOLVSDHSA-N |
| XLogP | 7.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.64 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |