C25H42O — CID 143290315
(6R)-6-[(4E)-4-(2-cyclohexylideneethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]heptan-2-ol (PubChem CID 143290315) has the molecular formula C25H42O and a molecular weight of 358.61 g/mol. Its IUPAC name is (6R)-6-[(4E)-4-(2-cyclohexylideneethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]heptan-2-ol.
| Compound Name | (6R)-6-[(4E)-4-(2-cyclohexylideneethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]heptan-2-ol |
|---|---|
| PubChem CID | 143290315 |
| Molecular Formula | C25H42O |
| Molecular Weight | 358.61 g/mol |
| Exact Mass | 358.32 |
| IUPAC Name | (6R)-6-[(4E)-4-(2-cyclohexylideneethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]heptan-2-ol |
| SMILES | CC(O)CCC[C@@H](C)C1CCC2/C(=C/C=C3CCCCC3)CCCC21C |
| InChI | InChI=1S/C25H42O/c1-19(9-7-10-20(2)26)23-16-17-24-22(13-8-18-25(23,24)3)15-14-21-11-5-4-6-12-21/h14-15,19-20,23-24,26H,4-13,16-18H2,1-3H3/b22-15+/t19-,20?,23?,24?,25?/m1/s1 |
| InChIKey | GURWXQBZFHYGRH-LATJATTNSA-N |
| XLogP | 7.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.61 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |