C26H42O — CID 143290297
(6R)-6-[(4E,7aR)-7a-methyl-4-[(2Z)-2-(2-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]heptan-2-ol (PubChem CID 143290297) has the molecular formula C26H42O and a molecular weight of 370.62 g/mol. Its IUPAC name is (6R)-6-[(4E,7aR)-7a-methyl-4-[(2Z)-2-(2-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]heptan-2-ol.
| Compound Name | (6R)-6-[(4E,7aR)-7a-methyl-4-[(2Z)-2-(2-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]heptan-2-ol |
|---|---|
| PubChem CID | 143290297 |
| Molecular Formula | C26H42O |
| Molecular Weight | 370.62 g/mol |
| Exact Mass | 370.32 |
| IUPAC Name | (6R)-6-[(4E,7aR)-7a-methyl-4-[(2Z)-2-(2-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]heptan-2-ol |
| SMILES | C=C1CCCC/C1=C/C=C1\CCC[C@@]2(C)C1CCC2[C@H](C)CCCC(C)O |
| InChI | InChI=1S/C26H42O/c1-19-9-5-6-12-22(19)14-15-23-13-8-18-26(4)24(16-17-25(23)26)20(2)10-7-11-21(3)27/h14-15,20-21,24-25,27H,1,5-13,16-18H2,2-4H3/b22-14-,23-15+/t20-,21?,24?,25?,26-/m1/s1 |
| InChIKey | YRQAKESYDRXVLF-VAKQFTMYSA-N |
| XLogP | 7.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.62 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |