C25H38O2 — CID 123692044
5-[7a-methyl-4-[2-(2-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]hexanoic acid (PubChem CID 123692044) has the molecular formula C25H38O2 and a molecular weight of 370.58 g/mol. Its IUPAC name is 5-[7a-methyl-4-[2-(2-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]hexanoic acid.
| Compound Name | 5-[7a-methyl-4-[2-(2-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 123692044 |
| Molecular Formula | C25H38O2 |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.29 |
| IUPAC Name | 5-[7a-methyl-4-[2-(2-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]hexanoic acid |
| SMILES | C=C1CCCCC1=CC=C1CCCC2(C)C1CCC2C(C)CCCC(=O)O |
| InChI | InChI=1S/C25H38O2/c1-18-8-4-5-10-20(18)13-14-21-11-7-17-25(3)22(15-16-23(21)25)19(2)9-6-12-24(26)27/h13-14,19,22-23H,1,4-12,15-17H2,2-3H3,(H,26,27) |
| InChIKey | LOHGYHQMGFEQQP-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |