C34H59NO3 — CID 145068963
(6R)-6-[(4E)-7a-methyl-4-[(2Z)-2-(2-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-ol;N-(3-hydroxypropyl)-2-methylpropanamide (PubChem CID 145068963) has the molecular formula C34H59NO3 and a molecular weight of 529.85 g/mol. Its IUPAC name is (6R)-6-[(4E)-7a-methyl-4-[(2Z)-2-(2-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-ol;N-(3-hydroxypropyl)-2-methylpropanamide.
| Compound Name | (6R)-6-[(4E)-7a-methyl-4-[(2Z)-2-(2-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-ol;N-(3-hydroxypropyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 145068963 |
| Molecular Formula | C34H59NO3 |
| Molecular Weight | 529.85 g/mol |
| Exact Mass | 529.45 |
| IUPAC Name | (6R)-6-[(4E)-7a-methyl-4-[(2Z)-2-(2-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-ol;N-(3-hydroxypropyl)-2-methylpropanamide |
| SMILES | C=C1CCCC/C1=C/C=C1\CCCC2(C)C1CCC2[C@H](C)CCCC(C)(C)O.CC(C)C(=O)NCCCO |
| InChI | InChI=1S/C27H44O.C7H15NO2/c1-20-10-6-7-12-22(20)14-15-23-13-9-19-27(5)24(16-17-25(23)27)21(2)11-8-18-26(3,4)28;1-6(2)7(10)8-4-3-5-9/h14-15,21,24-25,28H,1,6-13,16-19H2,2-5H3;6,9H,3-5H2,1-2H3,(H,8,10)/b22-14-,23-15+;/t21-,24?,25?,27?;/m1./s1 |
| InChIKey | HYLNKIJIAFTJCJ-FZQQFXIQSA-N |
| XLogP | 7.90 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.85 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|