C29H48O2 — CID 130348592
trans-(1R,3R,5Z)-5-[(2E)-2-[(7aR)-1-[(2S,3S)-6-hydroxy-3,6-dimethylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-3-methyl-2-methylidenecyclohexan-1-ol (PubChem CID 130348592) has the molecular formula C29H48O2 and a molecular weight of 428.70 g/mol. Its IUPAC name is trans-(1R,3R,5Z)-5-[(2E)-2-[(7aR)-1-[(2S,3S)-6-hydroxy-3,6-dimethylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-3-methyl-2-methylidenecyclohexan-1-ol.
| Compound Name | trans-(1R,3R,5Z)-5-[(2E)-2-[(7aR)-1-[(2S,3S)-6-hydroxy-3,6-dimethylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-3-methyl-2-methylidenecyclohexan-1-ol |
|---|---|
| PubChem CID | 130348592 |
| Molecular Formula | C29H48O2 |
| Molecular Weight | 428.70 g/mol |
| Exact Mass | 428.37 |
| IUPAC Name | trans-(1R,3R,5Z)-5-[(2E)-2-[(7aR)-1-[(2S,3S)-6-hydroxy-3,6-dimethylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-3-methyl-2-methylidenecyclohexan-1-ol |
| SMILES | C=C1[C@H](C)C/C(=C/C=C2\CCC[C@@]3(C)C2CCC3[C@@H](C)[C@@H](C)CCC(C)(C)O)C[C@H]1O |
| InChI | InChI=1S/C29H48O2/c1-19(14-16-28(5,6)31)21(3)25-12-13-26-24(9-8-15-29(25,26)7)11-10-23-17-20(2)22(4)27(30)18-23/h10-11,19-21,25-27,30-31H,4,8-9,12-18H2,1-3,5-7H3/b23-10-,24-11+/t19-,20+,21-,25?,26?,27+,29+/m0/s1 |
| InChIKey | IYIPBYQFFUJISU-QRGOJRISSA-N |
| XLogP | 7.23 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.70 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|