C20H36 — CID 72511490
4-ethylidene-7a-methyl-1-(6-methylheptan-2-yl)-2,3,3a,5,6,7-hexahydro-1H-indene (PubChem CID 72511490) has the molecular formula C20H36 and a molecular weight of 276.51 g/mol. Its IUPAC name is 4-ethylidene-7a-methyl-1-(6-methylheptan-2-yl)-2,3,3a,5,6,7-hexahydro-1H-indene.
| Compound Name | 4-ethylidene-7a-methyl-1-(6-methylheptan-2-yl)-2,3,3a,5,6,7-hexahydro-1H-indene |
|---|---|
| PubChem CID | 72511490 |
| Molecular Formula | C20H36 |
| Molecular Weight | 276.51 g/mol |
| Exact Mass | 276.28 |
| IUPAC Name | 4-ethylidene-7a-methyl-1-(6-methylheptan-2-yl)-2,3,3a,5,6,7-hexahydro-1H-indene |
| SMILES | CC=C1CCCC2(C)C1CCC2C(C)CCCC(C)C |
| InChI | InChI=1S/C20H36/c1-6-17-11-8-14-20(5)18(12-13-19(17)20)16(4)10-7-9-15(2)3/h6,15-16,18-19H,7-14H2,1-5H3 |
| InChIKey | WVWIGTYQLKDTTR-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.51 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|