C20H32O — CID 149085434
(6R)-6-[(1R,3aS,4E,7aR)-4-ethylidene-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylhept-3-yn-2-ol (PubChem CID 149085434) has the molecular formula C20H32O and a molecular weight of 288.48 g/mol. Its IUPAC name is (6R)-6-[(1R,3aS,4E,7aR)-4-ethylidene-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylhept-3-yn-2-ol.
| Compound Name | (6R)-6-[(1R,3aS,4E,7aR)-4-ethylidene-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylhept-3-yn-2-ol |
|---|---|
| PubChem CID | 149085434 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | (6R)-6-[(1R,3aS,4E,7aR)-4-ethylidene-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylhept-3-yn-2-ol |
| SMILES | C/C=C1\CCC[C@]2(C)[C@@H]([C@H](C)CC#CC(C)(C)O)CC[C@@H]12 |
| InChI | InChI=1S/C20H32O/c1-6-16-10-8-14-20(5)17(11-12-18(16)20)15(2)9-7-13-19(3,4)21/h6,15,17-18,21H,8-12,14H2,1-5H3/b16-6+/t15-,17-,18+,20-/m1/s1 |
| InChIKey | QRDUKIRPLVWAJJ-LPNBDDQHSA-N |
| XLogP | 4.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|