C20H29IO3 — CID 57190145
(3S)-5-[(3R)-3-[(1R,7aR)-4-(iodomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butyl]-3-hydroxy-3-methylfuran-2-one (PubChem CID 57190145) has the molecular formula C20H29IO3 and a molecular weight of 444.35 g/mol. Its IUPAC name is (3S)-5-[(3R)-3-[(1R,7aR)-4-(iodomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butyl]-3-hydroxy-3-methylfuran-2-one.
| Compound Name | (3S)-5-[(3R)-3-[(1R,7aR)-4-(iodomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butyl]-3-hydroxy-3-methylfuran-2-one |
|---|---|
| PubChem CID | 57190145 |
| Molecular Formula | C20H29IO3 |
| Molecular Weight | 444.35 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | (3S)-5-[(3R)-3-[(1R,7aR)-4-(iodomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butyl]-3-hydroxy-3-methylfuran-2-one |
| SMILES | C[C@H](CCC1=C[C@](C)(O)C(=O)O1)[C@H]1CCC2C(=CI)CCC[C@@]21C |
| InChI | InChI=1S/C20H29IO3/c1-13(6-7-15-11-20(3,23)18(22)24-15)16-8-9-17-14(12-21)5-4-10-19(16,17)2/h11-13,16-17,23H,4-10H2,1-3H3/t13-,16-,17?,19-,20+/m1/s1 |
| InChIKey | MNXCDNPJKNBGIV-CKPWCGBLSA-N |
| XLogP | 5.13 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.35 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|