C22H36O4Si — CID 57037777
(3S)-5-[(3R)-3-[(1R,7aR)-7a-methyl-4-oxo-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butyl]-3-methyl-3-trimethylsilyloxyfuran-2-one (PubChem CID 57037777) has the molecular formula C22H36O4Si and a molecular weight of 392.61 g/mol. Its IUPAC name is (3S)-5-[(3R)-3-[(1R,7aR)-7a-methyl-4-oxo-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butyl]-3-methyl-3-trimethylsilyloxyfuran-2-one.
| Compound Name | (3S)-5-[(3R)-3-[(1R,7aR)-7a-methyl-4-oxo-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butyl]-3-methyl-3-trimethylsilyloxyfuran-2-one |
|---|---|
| PubChem CID | 57037777 |
| Molecular Formula | C22H36O4Si |
| Molecular Weight | 392.61 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | (3S)-5-[(3R)-3-[(1R,7aR)-7a-methyl-4-oxo-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butyl]-3-methyl-3-trimethylsilyloxyfuran-2-one |
| SMILES | C[C@H](CCC1=C[C@](C)(O[Si](C)(C)C)C(=O)O1)[C@H]1CCC2C(=O)CCC[C@@]21C |
| InChI | InChI=1S/C22H36O4Si/c1-15(17-11-12-18-19(23)8-7-13-21(17,18)2)9-10-16-14-22(3,20(24)25-16)26-27(4,5)6/h14-15,17-18H,7-13H2,1-6H3/t15-,17-,18?,21-,22+/m1/s1 |
| InChIKey | UEFFQGIDBCXDBO-NHTYNSIYSA-N |
| XLogP | 5.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.61 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|