C25H42O4Si — CID 57178725
(3R)-5-[(3R)-3-[(1R,7aR)-7a-methyl-4-oxo-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butyl]-3-[tert-butyl(dimethyl)silyl]oxy-3-methylfuran-2-one (PubChem CID 57178725) has the molecular formula C25H42O4Si and a molecular weight of 434.69 g/mol. Its IUPAC name is (3R)-5-[(3R)-3-[(1R,7aR)-7a-methyl-4-oxo-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butyl]-3-[tert-butyl(dimethyl)silyl]oxy-3-methylfuran-2-one.
| Compound Name | (3R)-5-[(3R)-3-[(1R,7aR)-7a-methyl-4-oxo-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butyl]-3-[tert-butyl(dimethyl)silyl]oxy-3-methylfuran-2-one |
|---|---|
| PubChem CID | 57178725 |
| Molecular Formula | C25H42O4Si |
| Molecular Weight | 434.69 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | (3R)-5-[(3R)-3-[(1R,7aR)-7a-methyl-4-oxo-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butyl]-3-[tert-butyl(dimethyl)silyl]oxy-3-methylfuran-2-one |
| SMILES | C[C@H](CCC1=C[C@@](C)(O[Si](C)(C)C(C)(C)C)C(=O)O1)[C@H]1CCC2C(=O)CCC[C@@]21C |
| InChI | InChI=1S/C25H42O4Si/c1-17(19-13-14-20-21(26)10-9-15-24(19,20)5)11-12-18-16-25(6,22(27)28-18)29-30(7,8)23(2,3)4/h16-17,19-20H,9-15H2,1-8H3/t17-,19-,20?,24-,25-/m1/s1 |
| InChIKey | LAHCFLXEJBENGJ-CXIMMADUSA-N |
| XLogP | 6.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.69 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|