C24H36O5 — CID 22882744
(3S)-5-[(3R)-3-[(1R,7aR)-7a-methyl-4-oxo-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butyl]-3-methyl-3-(oxan-2-yloxy)furan-2-one (PubChem CID 22882744) has the molecular formula C24H36O5 and a molecular weight of 404.55 g/mol. Its IUPAC name is (3S)-5-[(3R)-3-[(1R,7aR)-7a-methyl-4-oxo-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butyl]-3-methyl-3-(oxan-2-yloxy)furan-2-one.
| Compound Name | (3S)-5-[(3R)-3-[(1R,7aR)-7a-methyl-4-oxo-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butyl]-3-methyl-3-(oxan-2-yloxy)furan-2-one |
|---|---|
| PubChem CID | 22882744 |
| Molecular Formula | C24H36O5 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | (3S)-5-[(3R)-3-[(1R,7aR)-7a-methyl-4-oxo-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butyl]-3-methyl-3-(oxan-2-yloxy)furan-2-one |
| SMILES | C[C@H](CCC1=C[C@](C)(OC2CCCCO2)C(=O)O1)[C@H]1CCC2C(=O)CCC[C@@]21C |
| InChI | InChI=1S/C24H36O5/c1-16(18-11-12-19-20(25)7-6-13-23(18,19)2)9-10-17-15-24(3,22(26)28-17)29-21-8-4-5-14-27-21/h15-16,18-19,21H,4-14H2,1-3H3/t16-,18-,19?,21?,23-,24+/m1/s1 |
| InChIKey | JAJHIVADHPEIKM-ISGZKAIUSA-N |
| XLogP | 4.93 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |